C64H60N4 — CID 140908719
4-carbazol-9-yl-2,6-dimethyl-N,N-bis[3-(5-methyl-4-phenyl-2-pyridinyl)-5-(2-methylpropyl)phenyl]aniline (PubChem CID 140908719) has the molecular formula C64H60N4 and a molecular weight of 885.21 g/mol. Its IUPAC name is 4-carbazol-9-yl-2,6-dimethyl-N,N-bis[3-(5-methyl-4-phenyl-2-pyridinyl)-5-(2-methylpropyl)phenyl]aniline.
| Compound Name | 4-carbazol-9-yl-2,6-dimethyl-N,N-bis[3-(5-methyl-4-phenyl-2-pyridinyl)-5-(2-methylpropyl)phenyl]aniline |
|---|---|
| PubChem CID | 140908719 |
| Molecular Formula | C64H60N4 |
| Molecular Weight | 885.21 g/mol |
| Exact Mass | 884.48 |
| IUPAC Name | 4-carbazol-9-yl-2,6-dimethyl-N,N-bis[3-(5-methyl-4-phenyl-2-pyridinyl)-5-(2-methylpropyl)phenyl]aniline |
| SMILES | Cc1cnc(-c2cc(CC(C)C)cc(N(c3cc(CC(C)C)cc(-c4cc(-c5ccccc5)c(C)cn4)c3)c3c(C)cc(-n4c5ccccc5c5ccccc54)cc3C)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C64H60N4/c1-41(2)27-47-31-51(60-37-58(45(7)39-65-60)49-19-11-9-12-20-49)35-54(33-47)67(64-43(5)29-53(30-44(64)6)68-62-25-17-15-23-56(62)57-24-16-18-26-63(57)68)55-34-48(28-42(3)4)32-52(36-55)61-38-59(46(8)40-66-61)50-21-13-10-14-22-50/h9-26,29-42H,27-28H2,1-8H3 |
| InChIKey | CTWKTQSKPPEOBL-UHFFFAOYSA-N |
| XLogP | 17.34 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.21 |
| LogP ≤ 5 | 17.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |