C62H51N3 — CID 140908600
N,N-bis[3-(5-methyl-4-phenyl-2-pyridinyl)-5-phenylphenyl]-4-(2-methylpropyl)naphthalen-1-amine (PubChem CID 140908600) has the molecular formula C62H51N3 and a molecular weight of 838.11 g/mol. Its IUPAC name is N,N-bis[3-(5-methyl-4-phenyl-2-pyridinyl)-5-phenylphenyl]-4-(2-methylpropyl)naphthalen-1-amine.
| Compound Name | N,N-bis[3-(5-methyl-4-phenyl-2-pyridinyl)-5-phenylphenyl]-4-(2-methylpropyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 140908600 |
| Molecular Formula | C62H51N3 |
| Molecular Weight | 838.11 g/mol |
| Exact Mass | 837.41 |
| IUPAC Name | N,N-bis[3-(5-methyl-4-phenyl-2-pyridinyl)-5-phenylphenyl]-4-(2-methylpropyl)naphthalen-1-amine |
| SMILES | Cc1cnc(-c2cc(-c3ccccc3)cc(N(c3cc(-c4ccccc4)cc(-c4cc(-c5ccccc5)c(C)cn4)c3)c3ccc(CC(C)C)c4ccccc34)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C62H51N3/c1-42(2)31-49-29-30-62(57-28-18-17-27-56(49)57)65(54-34-50(45-19-9-5-10-20-45)32-52(36-54)60-38-58(43(3)40-63-60)47-23-13-7-14-24-47)55-35-51(46-21-11-6-12-22-46)33-53(37-55)61-39-59(44(4)41-64-61)48-25-15-8-16-26-48/h5-30,32-42H,31H2,1-4H3 |
| InChIKey | GBWIHJHHGHNIJK-UHFFFAOYSA-N |
| XLogP | 16.92 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.11 |
| LogP ≤ 5 | 16.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |