About 9-[(Z)-1,2-dichloroethenyl]carbazole
9-[(Z)-1,2-dichloroethenyl]carbazole (PubChem CID 14091406) has the molecular formula C14H9Cl2N
and a molecular weight of 262.14 g/mol. Its IUPAC name is 9-[(Z)-1,2-dichloroethenyl]carbazole.
Molecular Properties
| Compound Name | 9-[(Z)-1,2-dichloroethenyl]carbazole |
| PubChem CID | 14091406 |
| Molecular Formula | C14H9Cl2N |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 9-[(Z)-1,2-dichloroethenyl]carbazole |
| SMILES | Cl/C=C(\Cl)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C14H9Cl2N/c15-9-14(16)17-12-7-3-1-5-10(12)11-6-2-4-8-13(11)17/h1-9H/b14-9+ |
| InChIKey | HEIKOFLGPWVVHT-NTEUORMPSA-N |
| XLogP | 5.03 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-[(Z)-1,2-dichloroethenyl]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(Z)-1,2-dichloroethenyl]carbazole?
The IUPAC name of 9-[(Z)-1,2-dichloroethenyl]carbazole (CID 14091406) is 9-[(Z)-1,2-dichloroethenyl]carbazole.
What is the SMILES notation for 9-[(Z)-1,2-dichloroethenyl]carbazole?
The canonical SMILES for 9-[(Z)-1,2-dichloroethenyl]carbazole is Cl/C=C(\Cl)n1c2ccccc2c2ccccc21.
What is the InChIKey of 9-[(Z)-1,2-dichloroethenyl]carbazole?
The InChIKey is HEIKOFLGPWVVHT-NTEUORMPSA-N. The full InChI is InChI=1S/C14H9Cl2N/c15-9-14(16)17-12-7-3-1-5-10(12)11-6-2-4-8-13(11)17/h1-9H/b14-9+.
What are the key properties of 9-[(Z)-1,2-dichloroethenyl]carbazole?
9-[(Z)-1,2-dichloroethenyl]carbazole has a molecular weight of 262.14 g/mol, XLogP of 5.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(Z)-1,2-dichloroethenyl]carbazole is sourced from PubChem (CID 14091406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).