C25H19F10O2S+ — CID 140915951
[4-[4,4,5,5,5-pentafluoro-3-hydroxy-3-(1,1,2,2,2-pentafluoroethyl)pentan-2-yl]oxyphenyl]-diphenylsulfanium (PubChem CID 140915951) has the molecular formula C25H19F10O2S+ and a molecular weight of 573.47 g/mol. Its IUPAC name is [4-[4,4,5,5,5-pentafluoro-3-hydroxy-3-(1,1,2,2,2-pentafluoroethyl)pentan-2-yl]oxyphenyl]-diphenylsulfanium.
| Compound Name | [4-[4,4,5,5,5-pentafluoro-3-hydroxy-3-(1,1,2,2,2-pentafluoroethyl)pentan-2-yl]oxyphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140915951 |
| Molecular Formula | C25H19F10O2S+ |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | [4-[4,4,5,5,5-pentafluoro-3-hydroxy-3-(1,1,2,2,2-pentafluoroethyl)pentan-2-yl]oxyphenyl]-diphenylsulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C(O)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H19F10O2S/c1-16(21(36,22(26,27)24(30,31)32)23(28,29)25(33,34)35)37-17-12-14-20(15-13-17)38(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-16,36H,1H3/q+1 |
| InChIKey | IYSDMPKEARWQFQ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|