About 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one
9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one (PubChem CID 140917431) has the molecular formula C15H15NO3
and a molecular weight of 257.29 g/mol. Its IUPAC name is 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one.
Molecular Properties
| Compound Name | 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one |
| PubChem CID | 140917431 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one |
| SMILES | COc1ccc2c(c1)COCc1cc(=O)n(C)cc1-2 |
| InChI | InChI=1S/C15H15NO3/c1-16-7-14-11(6-15(16)17)9-19-8-10-5-12(18-2)3-4-13(10)14/h3-7H,8-9H2,1-2H3 |
| InChIKey | XLERYPGETMKTJX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one?
The IUPAC name of 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one (CID 140917431) is 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one.
What is the SMILES notation for 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one?
The canonical SMILES for 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one is COc1ccc2c(c1)COCc1cc(=O)n(C)cc1-2.
What is the InChIKey of 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one?
The InChIKey is XLERYPGETMKTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c1-16-7-14-11(6-15(16)17)9-19-8-10-5-12(18-2)3-4-13(10)14/h3-7H,8-9H2,1-2H3.
What are the key properties of 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one?
9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one has a molecular weight of 257.29 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-2-methyl-5,7-dihydro-[2]benzoxepino[5,4-c]pyridin-3-one is sourced from PubChem (CID 140917431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).