C13H8O3 — CID 14091958
2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene-3-carboxylic acid (PubChem CID 14091958) has the molecular formula C13H8O3 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene-3-carboxylic acid.
| Compound Name | 2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene-3-carboxylic acid |
|---|---|
| PubChem CID | 14091958 |
| Molecular Formula | C13H8O3 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C13H8O3/c14-13(15)11-7-9-5-1-3-8-4-2-6-10(16-11)12(8)9/h1-7H,(H,14,15) |
| InChIKey | QCQCGDUOSYIGJR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |