C49H42N2OSSi2 — CID 140920086
[4-(benzimidazolo[2,1-b][1,3]benzothiazol-7-yl)-3-tert-butylphenyl]-(10,10-dimethylbenzo[b][1,4]benzoxasilin-4-yl)-diphenylsilane (PubChem CID 140920086) has the molecular formula C49H42N2OSSi2 and a molecular weight of 763.13 g/mol. Its IUPAC name is [4-(benzimidazolo[2,1-b][1,3]benzothiazol-7-yl)-3-tert-butylphenyl]-(10,10-dimethylbenzo[b][1,4]benzoxasilin-4-yl)-diphenylsilane.
| Compound Name | [4-(benzimidazolo[2,1-b][1,3]benzothiazol-7-yl)-3-tert-butylphenyl]-(10,10-dimethylbenzo[b][1,4]benzoxasilin-4-yl)-diphenylsilane |
|---|---|
| PubChem CID | 140920086 |
| Molecular Formula | C49H42N2OSSi2 |
| Molecular Weight | 763.13 g/mol |
| Exact Mass | 762.26 |
| IUPAC Name | [4-(benzimidazolo[2,1-b][1,3]benzothiazol-7-yl)-3-tert-butylphenyl]-(10,10-dimethylbenzo[b][1,4]benzoxasilin-4-yl)-diphenylsilane |
| SMILES | CC(C)(C)c1cc([Si](c2ccccc2)(c2ccccc2)c2cccc3c2Oc2ccccc2[Si]3(C)C)ccc1-c1cccc2c1nc1sc3ccccc3n12 |
| InChI | InChI=1S/C49H42N2OSSi2/c1-49(2,3)38-32-35(30-31-36(38)37-22-16-24-40-46(37)50-48-51(40)39-23-12-14-26-42(39)53-48)55(33-18-8-6-9-19-33,34-20-10-7-11-21-34)45-29-17-28-44-47(45)52-41-25-13-15-27-43(41)54(44,4)5/h6-32H,1-5H3 |
| InChIKey | BIVHXJGYMXJUKN-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.13 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|