C62H60O2Si3 — CID 168793219
bis[4-[10,10-bis(trideuteriomethyl)benzo[b][1,4]benzoxasilin-4-yl]-3-(1-deuteriocyclopentyl)phenyl]-diphenylsilane (PubChem CID 168793219) has the molecular formula C62H60O2Si3 and a molecular weight of 935.50 g/mol. Its IUPAC name is bis[4-[10,10-bis(trideuteriomethyl)benzo[b][1,4]benzoxasilin-4-yl]-3-(1-deuteriocyclopentyl)phenyl]-diphenylsilane.
| Compound Name | bis[4-[10,10-bis(trideuteriomethyl)benzo[b][1,4]benzoxasilin-4-yl]-3-(1-deuteriocyclopentyl)phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 168793219 |
| Molecular Formula | C62H60O2Si3 |
| Molecular Weight | 935.50 g/mol |
| Exact Mass | 934.48 |
| IUPAC Name | bis[4-[10,10-bis(trideuteriomethyl)benzo[b][1,4]benzoxasilin-4-yl]-3-(1-deuteriocyclopentyl)phenyl]-diphenylsilane |
| SMILES | [2H]C1(c2cc([Si](c3ccccc3)(c3ccccc3)c3ccc(-c4cccc5c4Oc4ccccc4[Si]5(C([2H])([2H])[2H])C([2H])([2H])[2H])c(C4([2H])CCCC4)c3)ccc2-c2cccc3c2Oc2ccccc2[Si]3(C([2H])([2H])[2H])C([2H])([2H])[2H])CCCC1 |
| InChI | InChI=1S/C62H60O2Si3/c1-65(2)57-33-17-15-31-55(57)63-61-51(29-19-35-59(61)65)49-39-37-47(41-53(49)43-21-11-12-22-43)67(45-25-7-5-8-26-45,46-27-9-6-10-28-46)48-38-40-50(54(42-48)44-23-13-14-24-44)52-30-20-36-60-62(52)64-56-32-16-18-34-58(56)66(60,3)4/h5-10,15-20,25-44H,11-14,21-24H2,1-4H3/i1D3,2D3,3D3,4D3,43D,44D |
| InChIKey | WAANBOXTAWLYJO-HIGZARODSA-N |
| XLogP | 11.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.50 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|