C48H41N3Si — CID 99771335
(9R)-3-[bis[(9S)-9-(methylamino)-9H-fluoren-3-yl]-phenylsilyl]-N-methyl-9H-fluoren-9-amine (PubChem CID 99771335) has the molecular formula C48H41N3Si and a molecular weight of 687.96 g/mol. Its IUPAC name is (9R)-3-[bis[(9S)-9-(methylamino)-9H-fluoren-3-yl]-phenylsilyl]-N-methyl-9H-fluoren-9-amine.
| Compound Name | (9R)-3-[bis[(9S)-9-(methylamino)-9H-fluoren-3-yl]-phenylsilyl]-N-methyl-9H-fluoren-9-amine |
|---|---|
| PubChem CID | 99771335 |
| Molecular Formula | C48H41N3Si |
| Molecular Weight | 687.96 g/mol |
| Exact Mass | 687.31 |
| IUPAC Name | (9R)-3-[bis[(9S)-9-(methylamino)-9H-fluoren-3-yl]-phenylsilyl]-N-methyl-9H-fluoren-9-amine |
| SMILES | CN[C@@H]1c2ccccc2-c2cc([Si](c3ccccc3)(c3ccc4c(c3)-c3ccccc3[C@@H]4NC)c3ccc4c(c3)-c3ccccc3[C@@H]4NC)ccc21 |
| InChI | InChI=1S/C48H41N3Si/c1-49-46-37-18-10-7-15-34(37)43-27-31(21-24-40(43)46)52(30-13-5-4-6-14-30,32-22-25-41-44(28-32)35-16-8-11-19-38(35)47(41)50-2)33-23-26-42-45(29-33)36-17-9-12-20-39(36)48(42)51-3/h4-29,46-51H,1-3H3/t46-,47-,48+/m0/s1 |
| InChIKey | UCEYGWJNUYEBNN-UTVRUGRBSA-N |
| XLogP | 6.93 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.96 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|