C20H12N4 — CID 140920405
(1E,7E,13E,19E)-3,9,15,21-tetrazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene (PubChem CID 140920405) has the molecular formula C20H12N4 and a molecular weight of 308.34 g/mol. Its IUPAC name is (1E,7E,13E,19E)-3,9,15,21-tetrazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene.
| Compound Name | (1E,7E,13E,19E)-3,9,15,21-tetrazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene |
|---|---|
| PubChem CID | 140920405 |
| Molecular Formula | C20H12N4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (1E,7E,13E,19E)-3,9,15,21-tetrazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene |
| SMILES | c1cnc2/c(c1)=c1/nccc/c1=c1\nccc\c1=c1/nccc/c1=2 |
| InChI | InChI=1S/C20H12N4/c1-5-13-17(21-9-1)14-6-2-11-23-19(14)16-8-4-12-24-20(16)15-7-3-10-22-18(13)15/h1-12H/b17-14+,18-13+,19-16+,20-15+ |
| InChIKey | WNXCJAFFACUKFO-XVTJTWFVSA-N |
| XLogP | 2.73 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |