C16H12N2 — CID 130290775
8,9-dihydroquinolino[6,7-g]quinoline (PubChem CID 130290775) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 8,9-dihydroquinolino[6,7-g]quinoline.
| Compound Name | 8,9-dihydroquinolino[6,7-g]quinoline |
|---|---|
| PubChem CID | 130290775 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 8,9-dihydroquinolino[6,7-g]quinoline |
| SMILES | C1=c2cc3cc4cccnc4cc3cc2=NCC1 |
| InChI | InChI=1S/C16H12N2/c1-3-11-7-13-8-12-4-2-6-18-16(12)10-14(13)9-15(11)17-5-1/h1,3-5,7-10H,2,6H2 |
| InChIKey | JNAYPGZLCIERHC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|