About cyclododeca[g]quinoline
cyclododeca[g]quinoline (PubChem CID 173006173) has the molecular formula C19H15N
and a molecular weight of 257.34 g/mol. Its IUPAC name is cyclododeca[g]quinoline.
Molecular Properties
| Compound Name | cyclododeca[g]quinoline |
| PubChem CID | 173006173 |
| Molecular Formula | C19H15N |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | cyclododeca[g]quinoline |
| SMILES | C1=CC=CC=Cc2cc3ncccc3cc2C=CC=C1 |
| InChI | InChI=1S/C19H15N/c1-2-4-6-8-11-17-15-19-18(12-9-13-20-19)14-16(17)10-7-5-3-1/h1-15H |
| InChIKey | VGTKGRHKBRCKTH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclododeca[g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclododeca[g]quinoline?
The IUPAC name of cyclododeca[g]quinoline (CID 173006173) is cyclododeca[g]quinoline.
What is the SMILES notation for cyclododeca[g]quinoline?
The canonical SMILES for cyclododeca[g]quinoline is C1=CC=CC=Cc2cc3ncccc3cc2C=CC=C1.
What is the InChIKey of cyclododeca[g]quinoline?
The InChIKey is VGTKGRHKBRCKTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N/c1-2-4-6-8-11-17-15-19-18(12-9-13-20-19)14-16(17)10-7-5-3-1/h1-15H.
What are the key properties of cyclododeca[g]quinoline?
cyclododeca[g]quinoline has a molecular weight of 257.34 g/mol, XLogP of 4.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclododeca[g]quinoline is sourced from PubChem (CID 173006173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).