C22H14N2 — CID 140920419
(1E,7Z,13E,19Z)-3,15-diazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene (PubChem CID 140920419) has the molecular formula C22H14N2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (1E,7Z,13E,19Z)-3,15-diazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene.
| Compound Name | (1E,7Z,13E,19Z)-3,15-diazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene |
|---|---|
| PubChem CID | 140920419 |
| Molecular Formula | C22H14N2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (1E,7Z,13E,19Z)-3,15-diazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene |
| SMILES | c1ccc2/c(c1)=c1/cccn/c1=c1\cccc\c1=c1/cccn/c1=2 |
| InChI | InChI=1S/C22H14N2/c1-3-9-17-15(7-1)19-11-5-13-24-22(19)18-10-4-2-8-16(18)20-12-6-14-23-21(17)20/h1-14H/b19-15-,20-16-,21-17+,22-18+ |
| InChIKey | KHLAAKAUFHGISI-NOUYCVRBSA-N |
| XLogP | 3.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |