C28H32N4O4 — CID 140928332
methyl 2-[5-[6-methoxy-4-[[1-(4-methylphenyl)piperidin-2-yl]methoxy]-1-benzofuran-2-yl]-1H-imidazol-2-yl]ethanimidate (PubChem CID 140928332) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is methyl 2-[5-[6-methoxy-4-[[1-(4-methylphenyl)piperidin-2-yl]methoxy]-1-benzofuran-2-yl]-1H-imidazol-2-yl]ethanimidate.
| Compound Name | methyl 2-[5-[6-methoxy-4-[[1-(4-methylphenyl)piperidin-2-yl]methoxy]-1-benzofuran-2-yl]-1H-imidazol-2-yl]ethanimidate |
|---|---|
| PubChem CID | 140928332 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | methyl 2-[5-[6-methoxy-4-[[1-(4-methylphenyl)piperidin-2-yl]methoxy]-1-benzofuran-2-yl]-1H-imidazol-2-yl]ethanimidate |
| SMILES | [H]/N=C(/Cc1ncc(-c2cc3c(OCC4CCCCN4c4ccc(C)cc4)cc(OC)cc3o2)[nH]1)OC |
| InChI | InChI=1S/C28H32N4O4/c1-18-7-9-19(10-8-18)32-11-5-4-6-20(32)17-35-24-12-21(33-2)13-25-22(24)14-26(36-25)23-16-30-28(31-23)15-27(29)34-3/h7-10,12-14,16,20,29H,4-6,11,15,17H2,1-3H3,(H,30,31)/b29-27- |
| InChIKey | JGSGVGRJJJEHPO-OHYPFYFLSA-N |
| XLogP | 5.74 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|