C29H32N4O4 — CID 140928366
methyl 2-[5-[6-methoxy-4-[[6-methylidene-1-(4-methylphenyl)piperidin-3-yl]methoxy]-1-benzofuran-2-yl]-1H-imidazol-2-yl]ethanimidate (PubChem CID 140928366) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is methyl 2-[5-[6-methoxy-4-[[6-methylidene-1-(4-methylphenyl)piperidin-3-yl]methoxy]-1-benzofuran-2-yl]-1H-imidazol-2-yl]ethanimidate.
| Compound Name | methyl 2-[5-[6-methoxy-4-[[6-methylidene-1-(4-methylphenyl)piperidin-3-yl]methoxy]-1-benzofuran-2-yl]-1H-imidazol-2-yl]ethanimidate |
|---|---|
| PubChem CID | 140928366 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | methyl 2-[5-[6-methoxy-4-[[6-methylidene-1-(4-methylphenyl)piperidin-3-yl]methoxy]-1-benzofuran-2-yl]-1H-imidazol-2-yl]ethanimidate |
| SMILES | [H]/N=C(/Cc1ncc(-c2cc3c(OCC4CCC(=C)N(c5ccc(C)cc5)C4)cc(OC)cc3o2)[nH]1)OC |
| InChI | InChI=1S/C29H32N4O4/c1-18-5-9-21(10-6-18)33-16-20(8-7-19(33)2)17-36-25-11-22(34-3)12-26-23(25)13-27(37-26)24-15-31-29(32-24)14-28(30)35-4/h5-6,9-13,15,20,30H,2,7-8,14,16-17H2,1,3-4H3,(H,31,32)/b30-28- |
| InChIKey | BJGSSYWHVZSPCJ-HYOGKJQXSA-N |
| XLogP | 6.12 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|