C5H5I2N — CID 14092853
2,5-diiodo-1-methylpyrrole (PubChem CID 14092853) has the molecular formula C5H5I2N and a molecular weight of 332.91 g/mol. Its IUPAC name is 2,5-diiodo-1-methylpyrrole.
| Compound Name | 2,5-diiodo-1-methylpyrrole |
|---|---|
| PubChem CID | 14092853 |
| Molecular Formula | C5H5I2N |
| Molecular Weight | 332.91 g/mol |
| Exact Mass | 332.85 |
| IUPAC Name | 2,5-diiodo-1-methylpyrrole |
| SMILES | Cn1c(I)ccc1I |
| InChI | InChI=1S/C5H5I2N/c1-8-4(6)2-3-5(8)7/h2-3H,1H3 |
| InChIKey | GTNSEAMPILDOSA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.91 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|