C24H21N4Y- — CID 140932448
1,1,2-trimethyl-3-[2-methyl-5-(2H-pyridin-2-id-3-yl)benzene-4-id-1-yl]imidazo[1,2-a]benzimidazol-3-ium;yttrium (PubChem CID 140932448) has the molecular formula C24H21N4Y- and a molecular weight of 454.37 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-[2-methyl-5-(2H-pyridin-2-id-3-yl)benzene-4-id-1-yl]imidazo[1,2-a]benzimidazol-3-ium;yttrium.
| Compound Name | 1,1,2-trimethyl-3-[2-methyl-5-(2H-pyridin-2-id-3-yl)benzene-4-id-1-yl]imidazo[1,2-a]benzimidazol-3-ium;yttrium |
|---|---|
| PubChem CID | 140932448 |
| Molecular Formula | C24H21N4Y- |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 1,1,2-trimethyl-3-[2-methyl-5-(2H-pyridin-2-id-3-yl)benzene-4-id-1-yl]imidazo[1,2-a]benzimidazol-3-ium;yttrium |
| SMILES | CC1=[N+](c2cc(-c3[c-]nccc3)[c-]cc2C)c2nc3ccccc3n2C1(C)C.[Y] |
| InChI | InChI=1S/C24H21N4.Y/c1-16-11-12-18(19-8-7-13-25-15-19)14-22(16)27-17(2)24(3,4)28-21-10-6-5-9-20(21)26-23(27)28;/h5-11,13-14H,1-4H3;/q-1; |
| InChIKey | NEOGVKZUDAJDQT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 33.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|