About 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium
1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium (PubChem CID 161059492) has the molecular formula C19H20N3+
and a molecular weight of 293.41 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium.
Molecular Properties
| Compound Name | 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium |
| PubChem CID | 161059492 |
| Molecular Formula | C19H20N3+ |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium |
| SMILES | [2H]C([2H])([2H])C1(C)C(C)=[N+](c2ccccc2C)c2nc3ccccc3n21 |
| InChI | InChI=1S/C19H20N3/c1-13-9-5-7-11-16(13)21-14(2)19(3,4)22-17-12-8-6-10-15(17)20-18(21)22/h5-12H,1-4H3/q+1/i3D3 |
| InChIKey | AIOZDLBBPBHEMA-HPRDVNIFSA-N |
| XLogP | 4.39 |
| TPSA | 20.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium?
The IUPAC name of 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium (CID 161059492) is 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium.
What is the SMILES notation for 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium?
The canonical SMILES for 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium is [2H]C([2H])([2H])C1(C)C(C)=[N+](c2ccccc2C)c2nc3ccccc3n21.
What is the InChIKey of 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium?
The InChIKey is AIOZDLBBPBHEMA-HPRDVNIFSA-N. The full InChI is InChI=1S/C19H20N3/c1-13-9-5-7-11-16(13)21-14(2)19(3,4)22-17-12-8-6-10-15(17)20-18(21)22/h5-12H,1-4H3/q+1/i3D3.
What are the key properties of 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium?
1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium has a molecular weight of 293.41 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3-(2-methylphenyl)-1-(trideuteriomethyl)imidazo[1,2-a]benzimidazol-3-ium is sourced from PubChem (CID 161059492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).