C18H22N5+ — CID 160577222
3-[3,5-dimethyl-2-(trideuteriomethyl)imidazol-4-yl]-1,1,2-trimethylimidazo[1,2-a]benzimidazol-3-ium (PubChem CID 160577222) has the molecular formula C18H22N5+ and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-[3,5-dimethyl-2-(trideuteriomethyl)imidazol-4-yl]-1,1,2-trimethylimidazo[1,2-a]benzimidazol-3-ium.
| Compound Name | 3-[3,5-dimethyl-2-(trideuteriomethyl)imidazol-4-yl]-1,1,2-trimethylimidazo[1,2-a]benzimidazol-3-ium |
|---|---|
| PubChem CID | 160577222 |
| Molecular Formula | C18H22N5+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 3-[3,5-dimethyl-2-(trideuteriomethyl)imidazol-4-yl]-1,1,2-trimethylimidazo[1,2-a]benzimidazol-3-ium |
| SMILES | [2H]C([2H])([2H])c1nc(C)c([N+]2=C(C)C(C)(C)n3c2nc2ccccc23)n1C |
| InChI | InChI=1S/C18H22N5/c1-11-16(21(6)13(3)19-11)22-12(2)18(4,5)23-15-10-8-7-9-14(15)20-17(22)23/h7-10H,1-6H3/q+1/i3D3 |
| InChIKey | CDWGABZDYJHFCS-HPRDVNIFSA-N |
| XLogP | 3.43 |
| TPSA | 38.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|