C12H13BrN2S — CID 3581291
3-bromo-4,4-dimethyl-2,3-dihydro-[1,3]thiazino[3,2-a]benzimidazole (PubChem CID 3581291) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is 3-bromo-4,4-dimethyl-2,3-dihydro-[1,3]thiazino[3,2-a]benzimidazole.
| Compound Name | 3-bromo-4,4-dimethyl-2,3-dihydro-[1,3]thiazino[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 3581291 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 3-bromo-4,4-dimethyl-2,3-dihydro-[1,3]thiazino[3,2-a]benzimidazole |
| SMILES | CC1(C)C(Br)CSc2nc3ccccc3n21 |
| InChI | InChI=1S/C12H13BrN2S/c1-12(2)10(13)7-16-11-14-8-5-3-4-6-9(8)15(11)12/h3-6,10H,7H2,1-2H3 |
| InChIKey | XNQIWPUQDGHQGR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|