C11H12N4S2 — CID 10400603
1,2-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-1-ylmethylthiourea (PubChem CID 10400603) has the molecular formula C11H12N4S2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 1,2-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-1-ylmethylthiourea.
| Compound Name | 1,2-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-1-ylmethylthiourea |
|---|---|
| PubChem CID | 10400603 |
| Molecular Formula | C11H12N4S2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1,2-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-1-ylmethylthiourea |
| SMILES | NC(=S)NCC1CSc2nc3ccccc3n21 |
| InChI | InChI=1S/C11H12N4S2/c12-10(16)13-5-7-6-17-11-14-8-3-1-2-4-9(8)15(7)11/h1-4,7H,5-6H2,(H3,12,13,16) |
| InChIKey | YRHVIVJXHKZBMH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|