About 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one
1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one (PubChem CID 156583377) has the molecular formula C9H6N2OS
and a molecular weight of 190.23 g/mol. Its IUPAC name is 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one.
Molecular Properties
| Compound Name | 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one |
| PubChem CID | 156583377 |
| Molecular Formula | C9H6N2OS |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one |
| SMILES | O=C1Cn2c(nc3ccccc32)S1 |
| InChI | InChI=1S/C9H6N2OS/c12-8-5-11-7-4-2-1-3-6(7)10-9(11)13-8/h1-4H,5H2 |
| InChIKey | TVDLSWOAUXBOCW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one?
The IUPAC name of 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one (CID 156583377) is 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one.
What is the SMILES notation for 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one?
The canonical SMILES for 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one is O=C1Cn2c(nc3ccccc32)S1.
What is the InChIKey of 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one?
The InChIKey is TVDLSWOAUXBOCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2OS/c12-8-5-11-7-4-2-1-3-6(7)10-9(11)13-8/h1-4H,5H2.
What are the key properties of 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one?
1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one has a molecular weight of 190.23 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-[1,3]thiazolo[3,2-a]benzimidazol-2-one is sourced from PubChem (CID 156583377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).