C18H10BrClF3N3O — CID 140937067
N-[1-[6-bromo-2-(6-chloro-1H-indol-2-yl)-1H-indol-3-yl]-2,2,2-trifluoroethylidene]hydroxylamine (PubChem CID 140937067) has the molecular formula C18H10BrClF3N3O and a molecular weight of 456.65 g/mol. Its IUPAC name is N-[1-[6-bromo-2-(6-chloro-1H-indol-2-yl)-1H-indol-3-yl]-2,2,2-trifluoroethylidene]hydroxylamine.
| Compound Name | N-[1-[6-bromo-2-(6-chloro-1H-indol-2-yl)-1H-indol-3-yl]-2,2,2-trifluoroethylidene]hydroxylamine |
|---|---|
| PubChem CID | 140937067 |
| Molecular Formula | C18H10BrClF3N3O |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | N-[1-[6-bromo-2-(6-chloro-1H-indol-2-yl)-1H-indol-3-yl]-2,2,2-trifluoroethylidene]hydroxylamine |
| SMILES | ON=C(c1c(-c2cc3ccc(Cl)cc3[nH]2)[nH]c2cc(Br)ccc12)C(F)(F)F |
| InChI | InChI=1S/C18H10BrClF3N3O/c19-9-2-4-11-13(6-9)25-16(15(11)17(26-27)18(21,22)23)14-5-8-1-3-10(20)7-12(8)24-14/h1-7,24-25,27H |
| InChIKey | AJLFEBQDAFNGMR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|