C23H24BrClN4O — CID 129127234
6-bromo-N-[2-(tert-butylamino)ethyl]-2-(5-chloro-1H-indol-2-yl)-1H-indole-3-carboxamide (PubChem CID 129127234) has the molecular formula C23H24BrClN4O and a molecular weight of 487.83 g/mol. Its IUPAC name is 6-bromo-N-[2-(tert-butylamino)ethyl]-2-(5-chloro-1H-indol-2-yl)-1H-indole-3-carboxamide.
| Compound Name | 6-bromo-N-[2-(tert-butylamino)ethyl]-2-(5-chloro-1H-indol-2-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 129127234 |
| Molecular Formula | C23H24BrClN4O |
| Molecular Weight | 487.83 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 6-bromo-N-[2-(tert-butylamino)ethyl]-2-(5-chloro-1H-indol-2-yl)-1H-indole-3-carboxamide |
| SMILES | CC(C)(C)NCCNC(=O)c1c(-c2cc3cc(Cl)ccc3[nH]2)[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C23H24BrClN4O/c1-23(2,3)27-9-8-26-22(30)20-16-6-4-14(24)12-18(16)29-21(20)19-11-13-10-15(25)5-7-17(13)28-19/h4-7,10-12,27-29H,8-9H2,1-3H3,(H,26,30) |
| InChIKey | PIJQQYSABRDHPH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.83 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|