C21H19BrClN3O3 — CID 129127157
6-bromo-2-(5-chloro-1H-indol-2-yl)-N-(2,2-dimethoxyethyl)-1H-indole-3-carboxamide (PubChem CID 129127157) has the molecular formula C21H19BrClN3O3 and a molecular weight of 476.76 g/mol. Its IUPAC name is 6-bromo-2-(5-chloro-1H-indol-2-yl)-N-(2,2-dimethoxyethyl)-1H-indole-3-carboxamide.
| Compound Name | 6-bromo-2-(5-chloro-1H-indol-2-yl)-N-(2,2-dimethoxyethyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 129127157 |
| Molecular Formula | C21H19BrClN3O3 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 6-bromo-2-(5-chloro-1H-indol-2-yl)-N-(2,2-dimethoxyethyl)-1H-indole-3-carboxamide |
| SMILES | COC(CNC(=O)c1c(-c2cc3cc(Cl)ccc3[nH]2)[nH]c2cc(Br)ccc12)OC |
| InChI | InChI=1S/C21H19BrClN3O3/c1-28-18(29-2)10-24-21(27)19-14-5-3-12(22)9-16(14)26-20(19)17-8-11-7-13(23)4-6-15(11)25-17/h3-9,18,25-26H,10H2,1-2H3,(H,24,27) |
| InChIKey | VKJVHXBZCQDLDM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|