C22H26F3N7O5 — CID 140938707
8-N-[6-[(2S)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide (PubChem CID 140938707) has the molecular formula C22H26F3N7O5 and a molecular weight of 525.49 g/mol. Its IUPAC name is 8-N-[6-[(2S)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[6-[(2S)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140938707 |
| Molecular Formula | C22H26F3N7O5 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 8-N-[6-[(2S)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ncc2c(n1)N(C(=O)Nc1cccc(OC[C@@H](O)CO)n1)C1CCCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H26F3N7O5/c1-12(22(23,24)25)27-20(35)18-26-8-15-19(30-18)32(13-4-3-7-31(15)9-13)21(36)29-16-5-2-6-17(28-16)37-11-14(34)10-33/h2,5-6,8,12-14,33-34H,3-4,7,9-11H2,1H3,(H,27,35)(H,28,29,36)/t12-,13?,14+/m1/s1 |
| InChIKey | WAOLOSIIUJSBSM-YIOYIWSBSA-N |
| XLogP | 1.31 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |