C24H31N7O5 — CID 145084636
8-N-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-pyridinyl]-5-N-ethyl-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide (PubChem CID 145084636) has the molecular formula C24H31N7O5 and a molecular weight of 497.56 g/mol. Its IUPAC name is 8-N-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-pyridinyl]-5-N-ethyl-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-pyridinyl]-5-N-ethyl-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 145084636 |
| Molecular Formula | C24H31N7O5 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 8-N-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-pyridinyl]-5-N-ethyl-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide |
| SMILES | CCNC(=O)c1ncc2c(n1)N(C(=O)Nc1cccc(OCC3COC(C)(C)O3)n1)C1CCCN2C1 |
| InChI | InChI=1S/C24H31N7O5/c1-4-25-22(32)20-26-11-17-21(29-20)31(15-7-6-10-30(17)12-15)23(33)28-18-8-5-9-19(27-18)34-13-16-14-35-24(2,3)36-16/h5,8-9,11,15-16H,4,6-7,10,12-14H2,1-3H3,(H,25,32)(H,27,28,33) |
| InChIKey | HUEHMRCEQHMLAU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |