C28H39N5O4 — CID 140941648
4-[[(3R)-4-cyclopentyl-1,3-dimethyl-2-oxo-3H-pyrido[2,3-b]pyrazin-6-yl]amino]-3-methoxy-N-(3-propoxypropyl)benzamide (PubChem CID 140941648) has the molecular formula C28H39N5O4 and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-[[(3R)-4-cyclopentyl-1,3-dimethyl-2-oxo-3H-pyrido[2,3-b]pyrazin-6-yl]amino]-3-methoxy-N-(3-propoxypropyl)benzamide.
| Compound Name | 4-[[(3R)-4-cyclopentyl-1,3-dimethyl-2-oxo-3H-pyrido[2,3-b]pyrazin-6-yl]amino]-3-methoxy-N-(3-propoxypropyl)benzamide |
|---|---|
| PubChem CID | 140941648 |
| Molecular Formula | C28H39N5O4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 4-[[(3R)-4-cyclopentyl-1,3-dimethyl-2-oxo-3H-pyrido[2,3-b]pyrazin-6-yl]amino]-3-methoxy-N-(3-propoxypropyl)benzamide |
| SMILES | CCCOCCCNC(=O)c1ccc(Nc2ccc3c(n2)N(C2CCCC2)[C@H](C)C(=O)N3C)c(OC)c1 |
| InChI | InChI=1S/C28H39N5O4/c1-5-16-37-17-8-15-29-27(34)20-11-12-22(24(18-20)36-4)30-25-14-13-23-26(31-25)33(21-9-6-7-10-21)19(2)28(35)32(23)3/h11-14,18-19,21H,5-10,15-17H2,1-4H3,(H,29,34)(H,30,31)/t19-/m1/s1 |
| InChIKey | BUTCOTTWKXJNLV-LJQANCHMSA-N |
| XLogP | 4.49 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|