C20H27IN2O4 — CID 140946933
ethyl (2S)-2-hydroxy-2-(7-iodo-5,8-dimethyl-3-oxo-2-piperidin-4-yl-1,4-dihydroisoquinolin-6-yl)acetate (PubChem CID 140946933) has the molecular formula C20H27IN2O4 and a molecular weight of 486.35 g/mol. Its IUPAC name is ethyl (2S)-2-hydroxy-2-(7-iodo-5,8-dimethyl-3-oxo-2-piperidin-4-yl-1,4-dihydroisoquinolin-6-yl)acetate.
| Compound Name | ethyl (2S)-2-hydroxy-2-(7-iodo-5,8-dimethyl-3-oxo-2-piperidin-4-yl-1,4-dihydroisoquinolin-6-yl)acetate |
|---|---|
| PubChem CID | 140946933 |
| Molecular Formula | C20H27IN2O4 |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | ethyl (2S)-2-hydroxy-2-(7-iodo-5,8-dimethyl-3-oxo-2-piperidin-4-yl-1,4-dihydroisoquinolin-6-yl)acetate |
| SMILES | CCOC(=O)[C@@H](O)c1c(C)c2c(c(C)c1I)CN(C1CCNCC1)C(=O)C2 |
| InChI | InChI=1S/C20H27IN2O4/c1-4-27-20(26)19(25)17-11(2)14-9-16(24)23(13-5-7-22-8-6-13)10-15(14)12(3)18(17)21/h13,19,22,25H,4-10H2,1-3H3/t19-/m0/s1 |
| InChIKey | NHXPHMDGJYEGMF-IBGZPJMESA-N |
| XLogP | 2.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|