C11H22N2O — CID 140947004
(5-butyl-1,4-diazabicyclo[2.2.2]octan-2-yl)methanol (PubChem CID 140947004) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is (5-butyl-1,4-diazabicyclo[2.2.2]octan-2-yl)methanol.
| Compound Name | (5-butyl-1,4-diazabicyclo[2.2.2]octan-2-yl)methanol |
|---|---|
| PubChem CID | 140947004 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (5-butyl-1,4-diazabicyclo[2.2.2]octan-2-yl)methanol |
| SMILES | CCCCC1CN2CCN1CC2CO |
| InChI | InChI=1S/C11H22N2O/c1-2-3-4-10-7-13-6-5-12(10)8-11(13)9-14/h10-11,14H,2-9H2,1H3 |
| InChIKey | JYOOZNACKRWOPR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |