C14H10N4 — CID 140950203
4-methyl-2,3,8,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene (PubChem CID 140950203) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-methyl-2,3,8,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene.
| Compound Name | 4-methyl-2,3,8,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
|---|---|
| PubChem CID | 140950203 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-methyl-2,3,8,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
| SMILES | Cc1cc2c3ncccc3c3cnccc3n2n1 |
| InChI | InChI=1S/C14H10N4/c1-9-7-13-14-10(3-2-5-16-14)11-8-15-6-4-12(11)18(13)17-9/h2-8H,1H3 |
| InChIKey | OQHWALDZXFJFAE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|