C15H11N3 — CID 140950302
2-methylpyrrolo[3,4-f][2,7]phenanthroline (PubChem CID 140950302) has the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-methylpyrrolo[3,4-f][2,7]phenanthroline.
| Compound Name | 2-methylpyrrolo[3,4-f][2,7]phenanthroline |
|---|---|
| PubChem CID | 140950302 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-methylpyrrolo[3,4-f][2,7]phenanthroline |
| SMILES | Cn1cc2c3ccncc3c3cccnc3c2c1 |
| InChI | InChI=1S/C15H11N3/c1-18-8-13-10-4-6-16-7-12(10)11-3-2-5-17-15(11)14(13)9-18/h2-9H,1H3 |
| InChIKey | GJEHWCNZNAVWNR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|