C14H8BrN3 — CID 140950757
3-bromo-2,5,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7,9,11,14,16-octaene (PubChem CID 140950757) has the molecular formula C14H8BrN3 and a molecular weight of 298.14 g/mol. Its IUPAC name is 3-bromo-2,5,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7,9,11,14,16-octaene.
| Compound Name | 3-bromo-2,5,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 140950757 |
| Molecular Formula | C14H8BrN3 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 3-bromo-2,5,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7,9,11,14,16-octaene |
| SMILES | Brc1cnc2c3ccccc3c3ncccc3n12 |
| InChI | InChI=1S/C14H8BrN3/c15-12-8-17-14-10-5-2-1-4-9(10)13-11(18(12)14)6-3-7-16-13/h1-8H |
| InChIKey | ZSDVQSOAEWUKKN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|