C17H11BrN2 — CID 170774308
9-(2-bromophenyl)pyrido[2,3-b]indole (PubChem CID 170774308) has the molecular formula C17H11BrN2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 9-(2-bromophenyl)pyrido[2,3-b]indole.
| Compound Name | 9-(2-bromophenyl)pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 170774308 |
| Molecular Formula | C17H11BrN2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 9-(2-bromophenyl)pyrido[2,3-b]indole |
| SMILES | Brc1ccccc1-n1c2ccccc2c2cccnc21 |
| InChI | InChI=1S/C17H11BrN2/c18-14-8-2-4-10-16(14)20-15-9-3-1-6-12(15)13-7-5-11-19-17(13)20/h1-11H |
| InChIKey | LYNDSLTYRJUBBC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |