C25H36N6O3SSi — CID 140959388
2-[[4-[1-[1-ethylsulfonyl-4-(isocyanomethyl)piperidin-4-yl]pyrrol-3-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140959388) has the molecular formula C25H36N6O3SSi and a molecular weight of 528.76 g/mol. Its IUPAC name is 2-[[4-[1-[1-ethylsulfonyl-4-(isocyanomethyl)piperidin-4-yl]pyrrol-3-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-[1-ethylsulfonyl-4-(isocyanomethyl)piperidin-4-yl]pyrrol-3-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140959388 |
| Molecular Formula | C25H36N6O3SSi |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 2-[[4-[1-[1-ethylsulfonyl-4-(isocyanomethyl)piperidin-4-yl]pyrrol-3-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | [C-]#[N+]CC1(n2ccc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)c2)CCN(S(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C25H36N6O3SSi/c1-6-35(32,33)31-13-9-25(10-14-31,18-26-2)30-12-7-21(17-30)23-22-8-11-29(24(22)28-19-27-23)20-34-15-16-36(3,4)5/h7-8,11-12,17,19H,6,9-10,13-16,18,20H2,1,3-5H3 |
| InChIKey | QCEJJFYNTSMDDX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 86.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|