C28H35F3N2O — CID 140961461
(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-[4-[(2,2,3,4,4-pentadeuterioazetidin-1-yl)methyl]-3-(1,1,2,2,2-pentadeuterioethyl)phenyl]ethanimine (PubChem CID 140961461) has the molecular formula C28H35F3N2O and a molecular weight of 482.66 g/mol. Its IUPAC name is (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-[4-[(2,2,3,4,4-pentadeuterioazetidin-1-yl)methyl]-3-(1,1,2,2,2-pentadeuterioethyl)phenyl]ethanimine.
| Compound Name | (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-[4-[(2,2,3,4,4-pentadeuterioazetidin-1-yl)methyl]-3-(1,1,2,2,2-pentadeuterioethyl)phenyl]ethanimine |
|---|---|
| PubChem CID | 140961461 |
| Molecular Formula | C28H35F3N2O |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | (E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-1-[4-[(2,2,3,4,4-pentadeuterioazetidin-1-yl)methyl]-3-(1,1,2,2,2-pentadeuterioethyl)phenyl]ethanimine |
| SMILES | [2H]C1C([2H])([2H])N(Cc2ccc(/C(C)=N/OCc3ccc(C4CCCCC4)c(C(F)(F)F)c3)cc2C([2H])([2H])C([2H])([2H])[2H])C1([2H])[2H] |
| InChI | InChI=1S/C28H35F3N2O/c1-3-22-17-24(11-12-25(22)18-33-14-7-15-33)20(2)32-34-19-21-10-13-26(23-8-5-4-6-9-23)27(16-21)28(29,30)31/h10-13,16-17,23H,3-9,14-15,18-19H2,1-2H3/b32-20+/i1D3,3D2,7D,14D2,15D2 |
| InChIKey | UJXFWRARCPDBIX-QUFNZXCPSA-N |
| XLogP | 7.46 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|