C27H30F4N2O3 — CID 11329613
1-[[4-[(Z)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-fluorophenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 11329613) has the molecular formula C27H30F4N2O3 and a molecular weight of 506.54 g/mol. Its IUPAC name is 1-[[4-[(Z)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-fluorophenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[(Z)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-fluorophenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 11329613 |
| Molecular Formula | C27H30F4N2O3 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 1-[[4-[(Z)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-fluorophenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | C/C(=N/OCc1ccc(C2CCCCC2)c(C(F)(F)F)c1)c1ccc(CN2CC(C(=O)O)C2)c(F)c1 |
| InChI | InChI=1S/C27H30F4N2O3/c1-17(20-8-9-21(25(28)12-20)13-33-14-22(15-33)26(34)35)32-36-16-18-7-10-23(19-5-3-2-4-6-19)24(11-18)27(29,30)31/h7-12,19,22H,2-6,13-16H2,1H3,(H,34,35)/b32-17- |
| InChIKey | DCOLWTCXKAPHTJ-KYHGBAKBSA-N |
| XLogP | 6.35 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|