C29H37F3N6O2 — CID 122467518
1-[1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidin-3-yl]tetrazolidin-5-one (PubChem CID 122467518) has the molecular formula C29H37F3N6O2 and a molecular weight of 558.65 g/mol. Its IUPAC name is 1-[1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidin-3-yl]tetrazolidin-5-one.
| Compound Name | 1-[1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidin-3-yl]tetrazolidin-5-one |
|---|---|
| PubChem CID | 122467518 |
| Molecular Formula | C29H37F3N6O2 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 1-[1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidin-3-yl]tetrazolidin-5-one |
| SMILES | CCc1cc(/C(C)=N/OCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1CN1CC(N2NNNC2=O)C1 |
| InChI | InChI=1S/C29H37F3N6O2/c1-3-21-14-23(10-11-24(21)15-37-16-25(17-37)38-28(39)33-35-36-38)19(2)34-40-18-20-9-12-26(22-7-5-4-6-8-22)27(13-20)29(30,31)32/h9-14,22,25,35-36H,3-8,15-18H2,1-2H3,(H,33,39)/b34-19+ |
| InChIKey | DLJWAUFPSOFOCJ-ALQBTCKLSA-N |
| XLogP | 5.39 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|