C30H37F3N2O3 — CID 167062229
2-[1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidin-2-yl]acetic acid (PubChem CID 167062229) has the molecular formula C30H37F3N2O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-[1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidin-2-yl]acetic acid.
| Compound Name | 2-[1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 167062229 |
| Molecular Formula | C30H37F3N2O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 2-[1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidin-2-yl]acetic acid |
| SMILES | CCc1cc(/C(C)=N/OCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1CN1CCC1CC(=O)O |
| InChI | InChI=1S/C30H37F3N2O3/c1-3-22-16-24(10-11-25(22)18-35-14-13-26(35)17-29(36)37)20(2)34-38-19-21-9-12-27(23-7-5-4-6-8-23)28(15-21)30(31,32)33/h9-12,15-16,23,26H,3-8,13-14,17-19H2,1-2H3,(H,36,37)/b34-20+ |
| InChIKey | LXSPCSPASXSNFG-QXUDOOCXSA-N |
| XLogP | 7.31 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|