C26H30BF3N2O3 — CID 89097102
CID 89097102 (PubChem CID 89097102) has the molecular formula C26H30BF3N2O3 and a molecular weight of 486.34 g/mol.
| Compound Name | CID 89097102 |
|---|---|
| PubChem CID | 89097102 |
| Molecular Formula | C26H30BF3N2O3 |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | — |
| SMILES | [B]c1cc(/C(C)=N/OCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1CNCCC(=O)O |
| InChI | InChI=1S/C26H30BF3N2O3/c1-17(20-8-9-21(24(27)14-20)15-31-12-11-25(33)34)32-35-16-18-7-10-22(19-5-3-2-4-6-19)23(13-18)26(28,29)30/h7-10,13-14,19,31H,2-6,11-12,15-16H2,1H3,(H,33,34)/b32-17+ |
| InChIKey | JDAPQEGSJAQAOJ-VTNSRFBWSA-N |
| XLogP | 5.05 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|