C28H33F3N2O3 — CID 169061005
3-[[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2,3-dihydro-1H-inden-2-yl]amino]propanoic acid (PubChem CID 169061005) has the molecular formula C28H33F3N2O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is 3-[[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2,3-dihydro-1H-inden-2-yl]amino]propanoic acid.
| Compound Name | 3-[[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2,3-dihydro-1H-inden-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 169061005 |
| Molecular Formula | C28H33F3N2O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 3-[[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2,3-dihydro-1H-inden-2-yl]amino]propanoic acid |
| SMILES | C/C(=N\OCc1ccc(C2CCCCC2)c(C(F)(F)F)c1)c1ccc2c(c1)CC(NCCC(=O)O)C2 |
| InChI | InChI=1S/C28H33F3N2O3/c1-18(21-8-9-22-15-24(16-23(22)14-21)32-12-11-27(34)35)33-36-17-19-7-10-25(20-5-3-2-4-6-20)26(13-19)28(29,30)31/h7-10,13-14,20,24,32H,2-6,11-12,15-17H2,1H3,(H,34,35)/b33-18+ |
| InChIKey | XNPPTFJRKLXXTA-DPNNOFEESA-N |
| XLogP | 6.23 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|