C24H29F3N2O3S — CID 11179154
3-[[5-[(Z)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]thiophen-2-yl]methylamino]propanoic acid (PubChem CID 11179154) has the molecular formula C24H29F3N2O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is 3-[[5-[(Z)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]thiophen-2-yl]methylamino]propanoic acid.
| Compound Name | 3-[[5-[(Z)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]thiophen-2-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 11179154 |
| Molecular Formula | C24H29F3N2O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 3-[[5-[(Z)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]thiophen-2-yl]methylamino]propanoic acid |
| SMILES | C/C(=N/OCc1ccc(C2CCCCC2)c(C(F)(F)F)c1)c1ccc(CNCCC(=O)O)s1 |
| InChI | InChI=1S/C24H29F3N2O3S/c1-16(22-10-8-19(33-22)14-28-12-11-23(30)31)29-32-15-17-7-9-20(18-5-3-2-4-6-18)21(13-17)24(25,26)27/h7-10,13,18,28H,2-6,11-12,14-15H2,1H3,(H,30,31)/b29-16- |
| InChIKey | SZEYBQSQIVXQHL-MWLSYYOVSA-N |
| XLogP | 6.32 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|