C27H32ClF3N2O2 — CID 126659420
3-[[2-chloro-4-[N-[2-[4-cyclohexyl-3-(trifluoromethyl)phenyl]ethyl]-C-methylcarbonimidoyl]phenyl]methylamino]propanoic acid (PubChem CID 126659420) has the molecular formula C27H32ClF3N2O2 and a molecular weight of 509.01 g/mol. Its IUPAC name is 3-[[2-chloro-4-[N-[2-[4-cyclohexyl-3-(trifluoromethyl)phenyl]ethyl]-C-methylcarbonimidoyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[2-chloro-4-[N-[2-[4-cyclohexyl-3-(trifluoromethyl)phenyl]ethyl]-C-methylcarbonimidoyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 126659420 |
| Molecular Formula | C27H32ClF3N2O2 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 3-[[2-chloro-4-[N-[2-[4-cyclohexyl-3-(trifluoromethyl)phenyl]ethyl]-C-methylcarbonimidoyl]phenyl]methylamino]propanoic acid |
| SMILES | C/C(=N\CCc1ccc(C2CCCCC2)c(C(F)(F)F)c1)c1ccc(CNCCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C27H32ClF3N2O2/c1-18(21-8-9-22(25(28)16-21)17-32-13-12-26(34)35)33-14-11-19-7-10-23(20-5-3-2-4-6-20)24(15-19)27(29,30)31/h7-10,15-16,20,32H,2-6,11-14,17H2,1H3,(H,34,35)/b33-18+ |
| InChIKey | AGWGKJIYSSROOE-DPNNOFEESA-N |
| XLogP | 7.02 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|