C28H35F3N2O3 — CID 87260634
3-[[4-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]-[(E)-ethylideneamino]oxymethyl]-2-ethylphenyl]methylamino]propanoic acid (PubChem CID 87260634) has the molecular formula C28H35F3N2O3 and a molecular weight of 504.59 g/mol. Its IUPAC name is 3-[[4-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]-[(E)-ethylideneamino]oxymethyl]-2-ethylphenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]-[(E)-ethylideneamino]oxymethyl]-2-ethylphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 87260634 |
| Molecular Formula | C28H35F3N2O3 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 3-[[4-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]-[(E)-ethylideneamino]oxymethyl]-2-ethylphenyl]methylamino]propanoic acid |
| SMILES | C/C=N/OC(c1ccc(CNCCC(=O)O)c(CC)c1)c1ccc(C2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H35F3N2O3/c1-3-19-16-21(10-11-23(19)18-32-15-14-26(34)35)27(36-33-4-2)22-12-13-24(20-8-6-5-7-9-20)25(17-22)28(29,30)31/h4,10-13,16-17,20,27,32H,3,5-9,14-15,18H2,1-2H3,(H,34,35)/b33-4+ |
| InChIKey | CKPMLQHEBOBHIS-CCTIHRSFSA-N |
| XLogP | 6.99 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|