C28H38N2O3 — CID 91611620
3-[[4-[1-[(4-cyclohexyl-3-methylphenyl)methoxyamino]ethenyl]-2-ethylphenyl]methylamino]propanoic acid (PubChem CID 91611620) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 3-[[4-[1-[(4-cyclohexyl-3-methylphenyl)methoxyamino]ethenyl]-2-ethylphenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[1-[(4-cyclohexyl-3-methylphenyl)methoxyamino]ethenyl]-2-ethylphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 91611620 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 3-[[4-[1-[(4-cyclohexyl-3-methylphenyl)methoxyamino]ethenyl]-2-ethylphenyl]methylamino]propanoic acid |
| SMILES | C=C(NOCc1ccc(C2CCCCC2)c(C)c1)c1ccc(CNCCC(=O)O)c(CC)c1 |
| InChI | InChI=1S/C28H38N2O3/c1-4-23-17-25(11-12-26(23)18-29-15-14-28(31)32)21(3)30-33-19-22-10-13-27(20(2)16-22)24-8-6-5-7-9-24/h10-13,16-17,24,29-30H,3-9,14-15,18-19H2,1-2H3,(H,31,32) |
| InChIKey | GEEFBACGIUXHIP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|