C28H36N2O4 — CID 143098205
3-[[(5E)-5-[(4-cyclohexyl-3-methylphenyl)methoxyimino]-3,4-dihydro-2H-1-benzoxepin-8-yl]methylamino]propanoic acid (PubChem CID 143098205) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-[[(5E)-5-[(4-cyclohexyl-3-methylphenyl)methoxyimino]-3,4-dihydro-2H-1-benzoxepin-8-yl]methylamino]propanoic acid.
| Compound Name | 3-[[(5E)-5-[(4-cyclohexyl-3-methylphenyl)methoxyimino]-3,4-dihydro-2H-1-benzoxepin-8-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 143098205 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 3-[[(5E)-5-[(4-cyclohexyl-3-methylphenyl)methoxyimino]-3,4-dihydro-2H-1-benzoxepin-8-yl]methylamino]propanoic acid |
| SMILES | Cc1cc(CO/N=C2\CCCOc3cc(CNCCC(=O)O)ccc32)ccc1C1CCCCC1 |
| InChI | InChI=1S/C28H36N2O4/c1-20-16-22(10-11-24(20)23-6-3-2-4-7-23)19-34-30-26-8-5-15-33-27-17-21(9-12-25(26)27)18-29-14-13-28(31)32/h9-12,16-17,23,29H,2-8,13-15,18-19H2,1H3,(H,31,32)/b30-26+ |
| InChIKey | CJWZCFKXOTWEKX-URGPHPNLSA-N |
| XLogP | 5.70 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|