C25H29F3N2O2 — CID 59773058
3-[[2-[4-cyclohexyl-3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-5-yl]methylamino]propanoic acid (PubChem CID 59773058) has the molecular formula C25H29F3N2O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3-[[2-[4-cyclohexyl-3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-5-yl]methylamino]propanoic acid.
| Compound Name | 3-[[2-[4-cyclohexyl-3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-5-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 59773058 |
| Molecular Formula | C25H29F3N2O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 3-[[2-[4-cyclohexyl-3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-5-yl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc2c(c1)CN(c1ccc(C3CCCCC3)c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C25H29F3N2O2/c26-25(27,28)23-13-21(8-9-22(23)18-4-2-1-3-5-18)30-15-19-7-6-17(12-20(19)16-30)14-29-11-10-24(31)32/h6-9,12-13,18,29H,1-5,10-11,14-16H2,(H,31,32) |
| InChIKey | ARMLNBYYAIFJMD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|