C30H37F3N2O3 — CID 151744328
1-[[4-[N-[1-[4-cyclohexyl-3-(trifluoromethyl)phenyl]ethoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 151744328) has the molecular formula C30H37F3N2O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is 1-[[4-[N-[1-[4-cyclohexyl-3-(trifluoromethyl)phenyl]ethoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[N-[1-[4-cyclohexyl-3-(trifluoromethyl)phenyl]ethoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 151744328 |
| Molecular Formula | C30H37F3N2O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 1-[[4-[N-[1-[4-cyclohexyl-3-(trifluoromethyl)phenyl]ethoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | CCc1cc(C(C)=NOC(C)c2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1CN1CC(C(=O)O)C1 |
| InChI | InChI=1S/C30H37F3N2O3/c1-4-21-14-23(10-11-25(21)16-35-17-26(18-35)29(36)37)19(2)34-38-20(3)24-12-13-27(22-8-6-5-7-9-22)28(15-24)30(31,32)33/h10-15,20,22,26H,4-9,16-18H2,1-3H3,(H,36,37) |
| InChIKey | RNESSYXJYUJQAU-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|