C34H39F3N4O2 — CID 166118968
1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]-N-pyridin-4-ylazetidine-3-carboxamide (PubChem CID 166118968) has the molecular formula C34H39F3N4O2 and a molecular weight of 592.71 g/mol. Its IUPAC name is 1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]-N-pyridin-4-ylazetidine-3-carboxamide.
| Compound Name | 1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]-N-pyridin-4-ylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 166118968 |
| Molecular Formula | C34H39F3N4O2 |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]-N-pyridin-4-ylazetidine-3-carboxamide |
| SMILES | CCc1cc(/C(C)=N/OCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1CN1CC(C(=O)Nc2ccncc2)C1 |
| InChI | InChI=1S/C34H39F3N4O2/c1-3-25-18-27(10-11-28(25)19-41-20-29(21-41)33(42)39-30-13-15-38-16-14-30)23(2)40-43-22-24-9-12-31(26-7-5-4-6-8-26)32(17-24)34(35,36)37/h9-18,26,29H,3-8,19-22H2,1-2H3,(H,38,39,42)/b40-23+ |
| InChIKey | UUIBADQXAKWMIK-ZXTCRCEHSA-N |
| XLogP | 7.72 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|