C31H42F3N3O3 — CID 87710778
tert-butyl 3-[[6-[2-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]ethyl]-2-ethyl-3-pyridinyl]methylamino]propanoate (PubChem CID 87710778) has the molecular formula C31H42F3N3O3 and a molecular weight of 561.69 g/mol. Its IUPAC name is tert-butyl 3-[[6-[2-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]ethyl]-2-ethyl-3-pyridinyl]methylamino]propanoate.
| Compound Name | tert-butyl 3-[[6-[2-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]ethyl]-2-ethyl-3-pyridinyl]methylamino]propanoate |
|---|---|
| PubChem CID | 87710778 |
| Molecular Formula | C31H42F3N3O3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | tert-butyl 3-[[6-[2-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]ethyl]-2-ethyl-3-pyridinyl]methylamino]propanoate |
| SMILES | CCc1nc(CC=NOCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1CNCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H42F3N3O3/c1-5-28-24(20-35-17-16-29(38)40-30(2,3)4)12-13-25(37-28)15-18-36-39-21-22-11-14-26(23-9-7-6-8-10-23)27(19-22)31(32,33)34/h11-14,18-19,23,35H,5-10,15-17,20-21H2,1-4H3 |
| InChIKey | FRDGDKLKSXPKCC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|